CAS 1394291-25-8 appears in our catalog under these names: 2,4-Dibromo-6-chloro-1-isobutoxybenzene, 95%, 2,4-Dibromo-6-chloro-1-isobutoxybenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1,5-dibromo-3-chloro-2-(2-methylpropoxy)benzene (CAS 1394291-25-8) is a chemical compound with the molecular formula C10H11Br2ClO and a molecular weight of 342.45 g/mol. IUPAC name: 1,5-dibromo-3-chloro-2-(2-methylpropoxy)benzene. InChIKey: MJSOZFSUTZAJMB-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2ClO |
|---|---|
| Molecular weight | 342.45 g/mol |
| IUPAC name | 1,5-dibromo-3-chloro-2-(2-methylpropoxy)benzene |
| InChIKey | MJSOZFSUTZAJMB-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1Br)Br)Cl |
Computed by PubChem (NCBI)