Products 1394291-41-8

CAS 1394291-41-8 is the registry number for 4-[(Bromo-2-chlorophenyl)methyl]morpholine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(4-bromo-2-chlorophenyl)methyl]morpholine;hydrochloride (CAS 1394291-41-8) is a chemical compound with the molecular formula C11H14BrCl2NO and a molecular weight of 327.04 g/mol. IUPAC name: 4-[(4-bromo-2-chlorophenyl)methyl]morpholine;hydrochloride. InChIKey: DKRGCVSVLXUYDR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14BrCl2NO
Molecular weight327.04 g/mol
IUPAC name4-[(4-bromo-2-chlorophenyl)methyl]morpholine;hydrochloride
InChIKeyDKRGCVSVLXUYDR-UHFFFAOYSA-N
SMILESC1COCCN1CC2=C(C=C(C=C2)Br)Cl.Cl

Computed by PubChem (NCBI)