CAS 1394373-18-2 appears in our catalog under these names: 6-Chloro-5-iodo-2-(methylsulfonyl)-3h-imidazo[4,5-b]pyridine, 95%, 6-Chloro-5-iodo-2-(methylsulfonyl)-1h-imidazo[4,5-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-5-iodo-2-methylsulfonyl-1H-imidazo[4,5-b]pyridine (CAS 1394373-18-2) is a chemical compound with the molecular formula C7H5ClIN3O2S and a molecular weight of 357.56 g/mol. IUPAC name: 6-chloro-5-iodo-2-methylsulfonyl-1H-imidazo[4,5-b]pyridine. InChIKey: CGPYBQNRXLDREJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3O2S |
|---|---|
| Molecular weight | 357.56 g/mol |
| IUPAC name | 6-chloro-5-iodo-2-methylsulfonyl-1H-imidazo[4,5-b]pyridine |
| InChIKey | CGPYBQNRXLDREJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC2=NC(=C(C=C2N1)Cl)I |
Computed by PubChem (NCBI)