CAS 1394373-21-7 appears in our catalog under these names: 5-Chloro-6-iodo-3-nitropyridin-2-amine, 95%, 5–Chloro–6–iodo–3–nitropyridin–2–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-6-iodo-3-nitropyridin-2-amine (CAS 1394373-21-7) is a chemical compound with the molecular formula C5H3ClIN3O2 and a molecular weight of 299.45 g/mol. IUPAC name: 5-chloro-6-iodo-3-nitropyridin-2-amine. InChIKey: ONUNNXNTWARSMR-UHFFFAOYSA-N.
| Molecular formula | C5H3ClIN3O2 |
|---|---|
| Molecular weight | 299.45 g/mol |
| IUPAC name | 5-chloro-6-iodo-3-nitropyridin-2-amine |
| InChIKey | ONUNNXNTWARSMR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)I)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)