CAS 1394702-33-0 appears in our catalog under these names: 4-(Aminomethyl)-N,N-dimethylpiperidine-1-sulfonamide hydrochloride, 95%, 4-(Aminomethyl)-N,N-dimethylpiperidine-1-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 50mg, 0,5g.
4-(aminomethyl)-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride (CAS 1394702-33-0) is a chemical compound with the molecular formula C8H20ClN3O2S and a molecular weight of 257.78 g/mol. IUPAC name: 4-(aminomethyl)-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride. InChIKey: PIOTWGWGTATUNB-UHFFFAOYSA-N.
| Molecular formula | C8H20ClN3O2S |
|---|---|
| Molecular weight | 257.78 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride |
| InChIKey | PIOTWGWGTATUNB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CCC(CC1)CN.Cl |
Computed by PubChem (NCBI)