CAS 1394707-66-4 is the registry number for N-(4-(Carbamimidoylmethoxy)phenyl)-2,2-dimethylpropanamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[4-(2-amino-2-iminoethoxy)phenyl]-2,2-dimethylpropanamide;hydrochloride (CAS 1394707-66-4) is a chemical compound with the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. IUPAC name: N-[4-(2-amino-2-iminoethoxy)phenyl]-2,2-dimethylpropanamide;hydrochloride. InChIKey: ZRXFJVAAALECSI-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN3O2 |
|---|---|
| Molecular weight | 285.77 g/mol |
| IUPAC name | N-[4-(2-amino-2-iminoethoxy)phenyl]-2,2-dimethylpropanamide;hydrochloride |
| InChIKey | ZRXFJVAAALECSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=C(C=C1)OCC(=N)N.Cl |
Computed by PubChem (NCBI)