CAS 139481-38-2 appears in our catalog under these names: Azilsartan Impurity 52, Candesartan Cilexetil Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[[4-(2-cyanophenyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate (CAS 139481-38-2) is a chemical compound with the molecular formula C27H25N3O6 and a molecular weight of 487.5 g/mol. IUPAC name: methyl 2-[[4-(2-cyanophenyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate. InChIKey: PUMUDLJJTIMDFU-UHFFFAOYSA-N.
| Molecular formula | C27H25N3O6 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | methyl 2-[[4-(2-cyanophenyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrobenzoate |
| InChIKey | PUMUDLJJTIMDFU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C#N)C3=C(C=CC=C3[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)