Products 1394816-63-7
CAS 1394816-63-7 is the registry number for N-Methyl-N-(pyridin-4-yl)leucine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2-[methyl(pyridin-4-yl)amino]pentanoic acid;hydrochloride (CAS 1394816-63-7) is a chemical compound with the molecular formula C12H19ClN2O2 and a molecular weight of 258.74 g/mol. IUPAC name: 4-methyl-2-[methyl(pyridin-4-yl)amino]pentanoic acid;hydrochloride. InChIKey: MTTXKGYIEBWOFM-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | 4-methyl-2-[methyl(pyridin-4-yl)amino]pentanoic acid;hydrochloride |
| InChIKey | MTTXKGYIEBWOFM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)N(C)C1=CC=NC=C1.Cl |
Computed by PubChem (NCBI)