CAS 1394834-50-4 is the registry number for 9-(4-(9,9-Dimethyl-9H-fluoren-2-yl)quinazolin-2-yl)-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazole (CAS 1394834-50-4) is a chemical compound with the molecular formula C35H25N3 and a molecular weight of 487.6 g/mol. IUPAC name: 9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazole. InChIKey: BGUCZYLWBGTXLF-UHFFFAOYSA-N.
| Molecular formula | C35H25N3 |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | 9-[4-(9,9-dimethylfluoren-2-yl)quinazolin-2-yl]carbazole |
| InChIKey | BGUCZYLWBGTXLF-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4=NC(=NC5=CC=CC=C54)N6C7=CC=CC=C7C8=CC=CC=C86)C |
Computed by PubChem (NCBI)