CAS 1394834-88-8 is the registry number for 7-(4-(4-([1,1'-Biphenyl]-4-yl)quinazolin-2-yl)phenyl)-7H-benzo[c]carbazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-[4-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]benzo[c]carbazole (CAS 1394834-88-8) is a chemical compound with the molecular formula C42H27N3 and a molecular weight of 573.7 g/mol. IUPAC name: 7-[4-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]benzo[c]carbazole. InChIKey: OSMKZOGUGNURKA-UHFFFAOYSA-N.
| Molecular formula | C42H27N3 |
|---|---|
| Molecular weight | 573.7 g/mol |
| IUPAC name | 7-[4-[4-(4-phenylphenyl)quinazolin-2-yl]phenyl]benzo[c]carbazole |
| InChIKey | OSMKZOGUGNURKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC4=CC=CC=C43)C5=CC=C(C=C5)N6C7=C(C8=CC=CC=C8C=C7)C9=CC=CC=C96 |
Computed by PubChem (NCBI)