CAS 1394842-91-1 appears in our catalog under these names: Paroxetine EP Impurity A HCl (Desfluoro Paroxetine HCl), (3S,4R)-3-((1,3-Benzodioxol-5-yloxy)methyl)-4-phenylpiperidine Hydrochloride (Desfluoroparoxetine Hydrochloride), PAROXETINE RELATED COMPOUND B. Offered by: Chemat Brand, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 50mg, 15MG.
(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine;hydrochloride (CAS 1394842-91-1) is a chemical compound with the molecular formula C19H22ClNO3 and a molecular weight of 347.8 g/mol. IUPAC name: (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine;hydrochloride. InChIKey: XLYKTAGGMBYJOB-NBLXOJGSSA-N.
| Molecular formula | C19H22ClNO3 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-phenylpiperidine;hydrochloride |
| InChIKey | XLYKTAGGMBYJOB-NBLXOJGSSA-N |
| SMILES | C1CNC[C@H]([C@@H]1C2=CC=CC=C2)COC3=CC4=C(C=C3)OCO4.Cl |
Computed by PubChem (NCBI)