CAS 1394916-65-4 is the registry number for Rel-(1R,2R)-N1,N2-dimethylcyclohexane-1,2-diamine methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methanesulfonic acid;trans-(1R,2R)-1-N,2-N-dimethylcyclohexane-1,2-diamine (CAS 1394916-65-4) is a chemical compound with the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. IUPAC name: methanesulfonic acid;trans-(1R,2R)-1-N,2-N-dimethylcyclohexane-1,2-diamine. InChIKey: HPDIWDNMNLNMEK-SCLLHFNJSA-N.
| Molecular formula | C9H22N2O3S |
|---|---|
| Molecular weight | 238.35 g/mol |
| IUPAC name | methanesulfonic acid;trans-(1R,2R)-1-N,2-N-dimethylcyclohexane-1,2-diamine |
| InChIKey | HPDIWDNMNLNMEK-SCLLHFNJSA-N |
| SMILES | CN[C@@H]1CCCC[C@H]1NC.CS(=O)(=O)O |
Computed by PubChem (NCBI)