CAS 1394953-65-1 is the registry number for 4-Fluoro-3-methyl-5-nitrophenol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-fluoro-3-methyl-5-nitrophenol (CAS 1394953-65-1) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 4-fluoro-3-methyl-5-nitrophenol. InChIKey: BSPKOTMXYOHBIR-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 4-fluoro-3-methyl-5-nitrophenol |
| InChIKey | BSPKOTMXYOHBIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)