CAS 1395084-25-9 appears in our catalog under these names: MS436, 4-((1E)-2-(2-Amino-4-hydroxy-5-methylphenyl)diazenyl)-N-2-pyridinylbenzenesulfonamide, MS436/ 95.83% (existing batch purity), MS436 98+%, MS436, 99.94%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 25mg, 50mg, 5mg, 10mg, 100mg, 200mg, 10mM (in 1ml dmso), 250mg.
4-[(2-amino-4-hydroxy-5-methylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide (CAS 1395084-25-9) is a chemical compound with the molecular formula C18H17N5O3S and a molecular weight of 383.4 g/mol. IUPAC name: 4-[(2-amino-4-hydroxy-5-methylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide. InChIKey: DZTGIRNXWSZBIM-UHFFFAOYSA-N.
| Molecular formula | C18H17N5O3S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 4-[(2-amino-4-hydroxy-5-methylphenyl)diazenyl]-N-pyridin-2-ylbenzenesulfonamide |
| InChIKey | DZTGIRNXWSZBIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)N)N=NC2=CC=C(C=C2)S(=O)(=O)NC3=CC=CC=N3 |
Computed by PubChem (NCBI)