CAS 139520-96-0 is the registry number for 1-Propyl-1-(2-(2,4,6-trichloro-3-hydroxyphenoxy)ethyl)urea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-propyl-1-[2-(2,4,6-trichloro-3-hydroxyphenoxy)ethyl]urea (CAS 139520-96-0) is a chemical compound with the molecular formula C12H15Cl3N2O3 and a molecular weight of 341.6 g/mol. IUPAC name: 1-propyl-1-[2-(2,4,6-trichloro-3-hydroxyphenoxy)ethyl]urea. InChIKey: XPDKDQRDRFEEFU-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl3N2O3 |
|---|---|
| Molecular weight | 341.6 g/mol |
| IUPAC name | 1-propyl-1-[2-(2,4,6-trichloro-3-hydroxyphenoxy)ethyl]urea |
| InChIKey | XPDKDQRDRFEEFU-UHFFFAOYSA-N |
| SMILES | CCCN(CCOC1=C(C=C(C(=C1Cl)O)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)