CAS 1395492-59-7 is the registry number for 5-(1-(tert-Butyl)-2-methyl-1H-benzo[d]imidazol-6-yl)thiazol-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-tert-butyl-2-methylbenzimidazol-5-yl)-1,3-thiazol-2-amine (CAS 1395492-59-7) is a chemical compound with the molecular formula C15H18N4S and a molecular weight of 286.4 g/mol. IUPAC name: 5-(3-tert-butyl-2-methylbenzimidazol-5-yl)-1,3-thiazol-2-amine. InChIKey: YNNNRPOHINNDLC-UHFFFAOYSA-N.
| Molecular formula | C15H18N4S |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 5-(3-tert-butyl-2-methylbenzimidazol-5-yl)-1,3-thiazol-2-amine |
| InChIKey | YNNNRPOHINNDLC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)(C)C)C=C(C=C2)C3=CN=C(S3)N |
Computed by PubChem (NCBI)