Products 1395886-20-0
CAS 1395886-20-0 is the registry number for AJI-214. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4-(2-chloroanilino)-5-fluoropyrimidin-2-yl]amino]benzamide (CAS 1395886-20-0) is a chemical compound with the molecular formula C17H13ClFN5O and a molecular weight of 357.8 g/mol. IUPAC name: 4-[[4-(2-chloroanilino)-5-fluoropyrimidin-2-yl]amino]benzamide. InChIKey: XSPXJYVALVHTAJ-UHFFFAOYSA-N.
| Molecular formula | C17H13ClFN5O |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 4-[[4-(2-chloroanilino)-5-fluoropyrimidin-2-yl]amino]benzamide |
| InChIKey | XSPXJYVALVHTAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=NC(=NC=C2F)NC3=CC=C(C=C3)C(=O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
Bisanilinopyrimidine, 9m, orb2665244