CAS 13960-80-0 is the registry number for TRIMETHYL-D9-AMINE, 99 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine (CAS 13960-80-0) is a chemical compound with the molecular formula C3H9N and a molecular weight of 68.17 g/mol. IUPAC name: 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine. InChIKey: GETQZCLCWQTVFV-GQALSZNTSA-N.
| Molecular formula | C3H9N |
|---|---|
| Molecular weight | 68.17 g/mol |
| IUPAC name | 1,1,1-trideuterio-N,N-bis(trideuteriomethyl)methanamine |
| InChIKey | GETQZCLCWQTVFV-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)