Products 1396006-71-5
CAS 1396006-71-5 appears in our catalog under these names: Ro 6842262, LPA1 receptor antagonist 1/ 99.58% (existing batch purity), LPA1 Receptor Antagonist 1, LPA1 receptor antagonist 1, 99.13%. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
1-[4-[4-[4-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]triazol-1-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid (CAS 1396006-71-5) is a chemical compound with the molecular formula C28H26N4O4 and a molecular weight of 482.5 g/mol. IUPAC name: 1-[4-[4-[4-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]triazol-1-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid. InChIKey: PXQUHYSYFWQRMF-LJQANCHMSA-N.
| Molecular formula | C28H26N4O4 |
|---|---|
| Molecular weight | 482.5 g/mol |
| IUPAC name | 1-[4-[4-[4-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]triazol-1-yl]phenyl]phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | PXQUHYSYFWQRMF-LJQANCHMSA-N |
| SMILES | CC1=C(N(N=N1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4(CC4)C(=O)O)NC(=O)O[C@H](C)C5=CC=CC=C5 |
Computed by PubChem (NCBI)