Products 1396338-09-2

CAS 1396338-09-2 is the registry number for tris(2,2-difluoroethyl) borate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tris(2,2-difluoroethyl) borate (CAS 1396338-09-2) is a chemical compound with the molecular formula C6H9BF6O3 and a molecular weight of 253.94 g/mol. IUPAC name: tris(2,2-difluoroethyl) borate. InChIKey: QIIPFRVUQAVEFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BF6O3
Molecular weight253.94 g/mol
IUPAC nametris(2,2-difluoroethyl) borate
InChIKeyQIIPFRVUQAVEFJ-UHFFFAOYSA-N
SMILESB(OCC(F)F)(OCC(F)F)OCC(F)F

Computed by PubChem (NCBI)