CAS 1396893-44-9 appears in our catalog under these names: 1,1,1-Trifluoro-2-(4-methylpyridin-2-yl)propan-2-yl methanesulfonate, 98%, 98%, 2-Pyridinemethanol, α,4-dimethyl-α-(trifluoromethyl)-, 2-methanesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl] methanesulfonate (CAS 1396893-44-9) is a chemical compound with the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. IUPAC name: [1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl] methanesulfonate. InChIKey: YYBOINGMWTWKGU-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO3S |
|---|---|
| Molecular weight | 283.27 g/mol |
| IUPAC name | [1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl] methanesulfonate |
| InChIKey | YYBOINGMWTWKGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C(C)(C(F)(F)F)OS(=O)(=O)C |
Computed by PubChem (NCBI)