Products 1396962-91-6

CAS 1396962-91-6 appears in our catalog under these names: 3-Carbamoyl-2-(2-fluorobenzenesulfonamido)propanoic acid, 95%, 3-Carbamoyl-2-(2-fluorobenzenesulfonamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-amino-2-[(2-fluorophenyl)sulfonylamino]-4-oxobutanoic acid (CAS 1396962-91-6) is a chemical compound with the molecular formula C10H11FN2O5S and a molecular weight of 290.27 g/mol. IUPAC name: 4-amino-2-[(2-fluorophenyl)sulfonylamino]-4-oxobutanoic acid. InChIKey: ZOGWFTFUKWIUPV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FN2O5S
Molecular weight290.27 g/mol
IUPAC name4-amino-2-[(2-fluorophenyl)sulfonylamino]-4-oxobutanoic acid
InChIKeyZOGWFTFUKWIUPV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)F)S(=O)(=O)NC(CC(=O)N)C(=O)O

Computed by PubChem (NCBI)