CAS 1396963-24-8 is the registry number for 3-(1H-Indol-3-yl)-2-(4-nitrobenzenesulfonamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid (CAS 1396963-24-8) is a chemical compound with the molecular formula C17H15N3O6S and a molecular weight of 389.4 g/mol. IUPAC name: 3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid. InChIKey: KJJXWLQWLLITGC-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O6S |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid |
| InChIKey | KJJXWLQWLLITGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NS(=O)(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)