Products 1396963-24-8

CAS 1396963-24-8 is the registry number for 3-(1H-Indol-3-yl)-2-(4-nitrobenzenesulfonamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid (CAS 1396963-24-8) is a chemical compound with the molecular formula C17H15N3O6S and a molecular weight of 389.4 g/mol. IUPAC name: 3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid. InChIKey: KJJXWLQWLLITGC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15N3O6S
Molecular weight389.4 g/mol
IUPAC name3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid
InChIKeyKJJXWLQWLLITGC-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NS(=O)(=O)C3=CC=C(C=C3)[N+](=O)[O-]

Computed by PubChem (NCBI)