Products 1396969-23-5
CAS 1396969-23-5 is the registry number for 5-FITC tyramide, 96.81%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg.
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea (CAS 1396969-23-5) is a chemical compound with the molecular formula C29H22N2O6S and a molecular weight of 526.6 g/mol. IUPAC name: 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea. InChIKey: IZHGETDBKCQWGN-UHFFFAOYSA-N.
| Molecular formula | C29H22N2O6S |
|---|---|
| Molecular weight | 526.6 g/mol |
| IUPAC name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[2-(4-hydroxyphenyl)ethyl]thiourea |
| InChIKey | IZHGETDBKCQWGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC(=S)NC2=CC3=C(C=C2)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC3=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-FITC tyramide, orb3135190