CAS 1397000-09-7 appears in our catalog under these names: Methyl 2-((4-chloro-3-nitrophenyl)formamido)propanoate, 95%, Methyl 2-((4-chloro-3-nitrophenyl)formamido)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 2-[(4-chloro-3-nitrobenzoyl)amino]propanoate (CAS 1397000-09-7) is a chemical compound with the molecular formula C11H11ClN2O5 and a molecular weight of 286.67 g/mol. IUPAC name: methyl 2-[(4-chloro-3-nitrobenzoyl)amino]propanoate. InChIKey: PISQBNDMQJLRAL-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O5 |
|---|---|
| Molecular weight | 286.67 g/mol |
| IUPAC name | methyl 2-[(4-chloro-3-nitrobenzoyl)amino]propanoate |
| InChIKey | PISQBNDMQJLRAL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)NC(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)