CAS 1397189-65-9 is the registry number for 6-(4-Iodobenzyl)-1-Methyl Pyrimidine-2,4-(1H,3H)-Dione. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
6-[(4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione (CAS 1397189-65-9) is a chemical compound with the molecular formula C12H11IN2O2 and a molecular weight of 342.13 g/mol. IUPAC name: 6-[(4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione. InChIKey: QWKJXTJMVCCVMT-UHFFFAOYSA-N.
| Molecular formula | C12H11IN2O2 |
|---|---|
| Molecular weight | 342.13 g/mol |
| IUPAC name | 6-[(4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione |
| InChIKey | QWKJXTJMVCCVMT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=O)NC1=O)CC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)