CAS 13972-93-5 is the registry number for 4,4'–Carbonylbis(isobenzofuran–1,3–dione). Offered by: GLPBio. Available pack sizes: 10g.
4-(1,3-dioxo-2-benzofuran-4-carbonyl)-2-benzofuran-1,3-dione (CAS 13972-93-5) is a chemical compound with the molecular formula C17H6O7 and a molecular weight of 322.22 g/mol. IUPAC name: 4-(1,3-dioxo-2-benzofuran-4-carbonyl)-2-benzofuran-1,3-dione. InChIKey: DLCQVSZPARLPHV-UHFFFAOYSA-N.
| Molecular formula | C17H6O7 |
|---|---|
| Molecular weight | 322.22 g/mol |
| IUPAC name | 4-(1,3-dioxo-2-benzofuran-4-carbonyl)-2-benzofuran-1,3-dione |
| InChIKey | DLCQVSZPARLPHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)C3=CC=CC4=C3C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)