Products 139726-29-7
CAS 139726-29-7 is the registry number for Dunnianol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-bis(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol (CAS 139726-29-7) is a chemical compound with the molecular formula C27H26O3 and a molecular weight of 398.5 g/mol. IUPAC name: 2,6-bis(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol. InChIKey: PLBCEMUNKQWXGZ-UHFFFAOYSA-N.
| Molecular formula | C27H26O3 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 2,6-bis(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
| InChIKey | PLBCEMUNKQWXGZ-UHFFFAOYSA-N |
| SMILES | C=CCC1=CC(=C(C=C1)O)C2=CC(=CC(=C2O)C3=C(C=CC(=C3)CC=C)O)CC=C |
Computed by PubChem (NCBI)