CAS 1398044-54-6 appears in our catalog under these names: 2-(T-Butoxycarbonylamido)-1,3-bis (carboxylethoxy)propane, 95%, Boc-NH-Bis(acid-PEG1-m) 95%, 3,3'-((2-((Tert-Butoxycarbonyl)Amino)Propane-1,3-Diyl)Bis(Oxy))Dipropionic Acid, 95%, 95%, Boc-NH-Bis(acid-PEG1-m), 95.0%. Offered by: Combi-blocks, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 1g, 100 mg, 25 mg, 50 mg, 250 mg.
3-[3-(2-carboxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoic acid (CAS 1398044-54-6) is a chemical compound with the molecular formula C14H25NO8 and a molecular weight of 335.35 g/mol. IUPAC name: 3-[3-(2-carboxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoic acid. InChIKey: PZUILVSYYIWPNP-UHFFFAOYSA-N.
| Molecular formula | C14H25NO8 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | 3-[3-(2-carboxyethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoic acid |
| InChIKey | PZUILVSYYIWPNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(COCCC(=O)O)COCCC(=O)O |
Computed by PubChem (NCBI)