Products 1398065-46-7
CAS 1398065-46-7 appears in our catalog under these names: 2-Chloroanisole-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, 1-Chloro-2-methoxybenzene-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1-chloro-2-(trideuteriomethoxy)benzene (CAS 1398065-46-7) is a chemical compound with the molecular formula C7H7ClO and a molecular weight of 145.60 g/mol. IUPAC name: 1-chloro-2-(trideuteriomethoxy)benzene. InChIKey: QGRPVMLBTFGQDQ-FIBGUPNXSA-N.
| Molecular formula | C7H7ClO |
|---|---|
| Molecular weight | 145.60 g/mol |
| IUPAC name | 1-chloro-2-(trideuteriomethoxy)benzene |
| InChIKey | QGRPVMLBTFGQDQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)