Products 1398065-52-5
CAS 1398065-52-5 appears in our catalog under these names: N,N,N',N'-Tetramethyl-1,3-propanediamine-d18, 99 atom % D, min 98% Chemical Purity, N1,N1,N3,N3-Tetramethylpropane-1,3-diamine-d18. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 50 mg, 100 mg, 5 mg, 25 mg, 1 mg, 10 mg.
1,1,2,2,3,3-hexadeuterio-N,N,N',N'-tetrakis(trideuteriomethyl)propane-1,3-diamine (CAS 1398065-52-5) is a chemical compound with the molecular formula C7H18N2 and a molecular weight of 148.34 g/mol. IUPAC name: 1,1,2,2,3,3-hexadeuterio-N,N,N',N'-tetrakis(trideuteriomethyl)propane-1,3-diamine. InChIKey: DMQSHEKGGUOYJS-UWBLXWIRSA-N.
| Molecular formula | C7H18N2 |
|---|---|
| Molecular weight | 148.34 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexadeuterio-N,N,N',N'-tetrakis(trideuteriomethyl)propane-1,3-diamine |
| InChIKey | DMQSHEKGGUOYJS-UWBLXWIRSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)