Products 1398065-53-6
CAS 1398065-53-6 appears in our catalog under these names: Isopropyl Acetate-d10, iso-Propyl Acetate-d10, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 250mg, 25mg, 0,5g, 0,25g.
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2,2,2-trideuterioacetate (CAS 1398065-53-6) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 112.19 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2,2,2-trideuterioacetate. InChIKey: JMMWKPVZQRWMSS-LSURFNHSSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 112.19 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 2,2,2-trideuterioacetate |
| InChIKey | JMMWKPVZQRWMSS-LSURFNHSSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)