Products 1398065-56-9
CAS 1398065-56-9 is the registry number for 3-Fluoroaniline-2,4,6-d3,ND2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
N,N,2,4,6-pentadeuterio-3-fluoroaniline (CAS 1398065-56-9) is a chemical compound with the molecular formula C6H6FN and a molecular weight of 116.15 g/mol. IUPAC name: N,N,2,4,6-pentadeuterio-3-fluoroaniline. InChIKey: QZVQQUVWFIZUBQ-TZVKMIMGSA-N.
| Molecular formula | C6H6FN |
|---|---|
| Molecular weight | 116.15 g/mol |
| IUPAC name | N,N,2,4,6-pentadeuterio-3-fluoroaniline |
| InChIKey | QZVQQUVWFIZUBQ-TZVKMIMGSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1N([2H])[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)