Products 1398065-57-0
CAS 1398065-57-0 appears in our catalog under these names: Benzyl-2,3,4,5,6-d5 Acetate, 99 atom % D, min 98% Chemical Purity, Benzyl acetate-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
(2,3,4,5,6-pentadeuteriophenyl)methyl acetate (CAS 1398065-57-0) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 155.20 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methyl acetate. InChIKey: QUKGYYKBILRGFE-VIQYUKPQSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methyl acetate |
| InChIKey | QUKGYYKBILRGFE-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)