Products 1398065-62-7
CAS 1398065-62-7 appears in our catalog under these names: Furfuryl-d5 Alcohol, >95% (GC), Furfuryl-d5 Alcohol, 99 atom % D, min 98% Chemical Purity, Furfuryl-d5 alcohol. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 2 mg, 1 mg, 10 mg.
Dideuterio-(3,4,5-trideuteriofuran-2-yl)methanol (CAS 1398065-62-7) is a chemical compound with the molecular formula C5H6O2 and a molecular weight of 103.13 g/mol. IUPAC name: dideuterio-(3,4,5-trideuteriofuran-2-yl)methanol. InChIKey: XPFVYQJUAUNWIW-QUWGTZMWSA-N.
| Molecular formula | C5H6O2 |
|---|---|
| Molecular weight | 103.13 g/mol |
| IUPAC name | dideuterio-(3,4,5-trideuteriofuran-2-yl)methanol |
| InChIKey | XPFVYQJUAUNWIW-QUWGTZMWSA-N |
| SMILES | [2H]C1=C(OC(=C1[2H])C([2H])([2H])O)[2H] |
Computed by PubChem (NCBI)