Products 1398065-64-9
CAS 1398065-64-9 appears in our catalog under these names: 3-Ethyl-d5-toluene, 99 atom % D, min 98% Chemical Purity, 1-Ethyl-3-methylbenzene-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5 mg, 10 mg, 25 mg.
1-methyl-3-(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 1398065-64-9) is a chemical compound with the molecular formula C9H12 and a molecular weight of 125.22 g/mol. IUPAC name: 1-methyl-3-(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: ZLCSFXXPPANWQY-WNWXXORZSA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 125.22 g/mol |
| IUPAC name | 1-methyl-3-(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | ZLCSFXXPPANWQY-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=CC(=C1)C |
Computed by PubChem (NCBI)