Products 1398065-67-2
CAS 1398065-67-2 appears in our catalog under these names: n-Pentyl-d11 Chloroformate, 99 atom % D, min 98% Chemical Purity, Pentyl carbonochloridate-d11. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl carbonochloridate (CAS 1398065-67-2) is a chemical compound with the molecular formula C6H11ClO2 and a molecular weight of 161.67 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl carbonochloridate. InChIKey: XHRRYUDVWPPWIP-GILSBCIXSA-N.
| Molecular formula | C6H11ClO2 |
|---|---|
| Molecular weight | 161.67 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl carbonochloridate |
| InChIKey | XHRRYUDVWPPWIP-GILSBCIXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OC(=O)Cl |
Computed by PubChem (NCBI)