Products 1398065-70-7
CAS 1398065-70-7 is the registry number for Butyric Anhydride-3,3,3',3',4,4,4,4',4',4'-d10, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
3,3,4,4,4-pentadeuteriobutanoyl 3,3,4,4,4-pentadeuteriobutanoate (CAS 1398065-70-7) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 168.26 g/mol. IUPAC name: 3,3,4,4,4-pentadeuteriobutanoyl 3,3,4,4,4-pentadeuteriobutanoate. InChIKey: YHASWHZGWUONAO-MWUKXHIBSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 168.26 g/mol |
| IUPAC name | 3,3,4,4,4-pentadeuteriobutanoyl 3,3,4,4,4-pentadeuteriobutanoate |
| InChIKey | YHASWHZGWUONAO-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC(=O)OC(=O)CC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)