Products 1398065-76-3
CAS 1398065-76-3 appears in our catalog under these names: 2-Nonanone-1,1,1,3,3-d5, 98 atom % D, min 98% Chemical Purity, 2-Nonanone-d5, Heptyl methyl ketone-d5. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 1g, 0,5g, 500mg, 1 mg.
1,1,1,3,3-pentadeuteriononan-2-one (CAS 1398065-76-3) is a chemical compound with the molecular formula C9H18O and a molecular weight of 147.27 g/mol. IUPAC name: 1,1,1,3,3-pentadeuteriononan-2-one. InChIKey: VKCYHJWLYTUGCC-QCCORQSASA-N.
| Molecular formula | C9H18O |
|---|---|
| Molecular weight | 147.27 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuteriononan-2-one |
| InChIKey | VKCYHJWLYTUGCC-QCCORQSASA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Heptyl methyl ketone-d5, 2-Nonanone-1,1,1,3,3-D5