CAS 1398065-85-4 is the registry number for N,N-Dimethyl-d6-4-nitrosoaniline, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
4-nitroso-N,N-bis(trideuteriomethyl)aniline (CAS 1398065-85-4) is a chemical compound with the molecular formula C8H10N2O and a molecular weight of 156.21 g/mol. IUPAC name: 4-nitroso-N,N-bis(trideuteriomethyl)aniline. InChIKey: CMEWLCATCRTSGF-WFGJKAKNSA-N.
| Molecular formula | C8H10N2O |
|---|---|
| Molecular weight | 156.21 g/mol |
| IUPAC name | 4-nitroso-N,N-bis(trideuteriomethyl)aniline |
| InChIKey | CMEWLCATCRTSGF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=C(C=C1)N=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)