Products 1398065-90-1
CAS 1398065-90-1 appears in our catalog under these names: 1-Acetylpiperazine-d4, 98.6%, N-Acetylpiperazine-3,3,5,5-d4, 98 atom % D, min 98% Chemical Purity, N–Acetylpiperazine–d4. Offered by: MedChemExpress, CDN, GLPBio. Available pack sizes: 10 mg, 50 mg, 5 mg, 25 mg, 0,25g, 0,1g, 100mg.
1-(3,3,5,5-tetradeuteriopiperazin-1-yl)ethanone (CAS 1398065-90-1) is a chemical compound with the molecular formula C6H12N2O and a molecular weight of 132.20 g/mol. IUPAC name: 1-(3,3,5,5-tetradeuteriopiperazin-1-yl)ethanone. InChIKey: PKDPUENCROCRCH-RRVWJQJTSA-N.
| Molecular formula | C6H12N2O |
|---|---|
| Molecular weight | 132.20 g/mol |
| IUPAC name | 1-(3,3,5,5-tetradeuteriopiperazin-1-yl)ethanone |
| InChIKey | PKDPUENCROCRCH-RRVWJQJTSA-N |
| SMILES | [2H]C1(CN(CC(N1)([2H])[2H])C(=O)C)[2H] |
Computed by PubChem (NCBI)