Products 1398066-14-2
CAS 1398066-14-2 appears in our catalog under these names: Ethyl 2-bromopropionate-d3, Ethyl (±)-2-Bromopropionate-3,3,3-d3, 99 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,5g, 0,25g.
Ethyl 2-bromo-3,3,3-trideuteriopropanoate (CAS 1398066-14-2) is a chemical compound with the molecular formula C5H9BrO2 and a molecular weight of 184.05 g/mol. IUPAC name: ethyl 2-bromo-3,3,3-trideuteriopropanoate. InChIKey: ARFLASKVLJTEJD-BMSJAHLVSA-N.
| Molecular formula | C5H9BrO2 |
|---|---|
| Molecular weight | 184.05 g/mol |
| IUPAC name | ethyl 2-bromo-3,3,3-trideuteriopropanoate |
| InChIKey | ARFLASKVLJTEJD-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OCC)Br |
Computed by PubChem (NCBI)