CAS 1398066-19-7 appears in our catalog under these names: N,N-Dimethyl-p-phenylenediamine-d6, 4-Amino-N,N-dimethyl-d6-aniline, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 25mg, 5mg, 0,1g, 0,05g.
4-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine (CAS 1398066-19-7) is a chemical compound with the molecular formula C8H12N2 and a molecular weight of 142.23 g/mol. IUPAC name: 4-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine. InChIKey: BZORFPDSXLZWJF-WFGJKAKNSA-N.
| Molecular formula | C8H12N2 |
|---|---|
| Molecular weight | 142.23 g/mol |
| IUPAC name | 4-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine |
| InChIKey | BZORFPDSXLZWJF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=C(C=C1)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)