CAS 1398511-24-4 is the registry number for 3,5-Dibromo-4-trityl-4h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
3,5-dibromo-4-trityl-1,2,4-triazole (CAS 1398511-24-4) is a chemical compound with the molecular formula C21H15Br2N3 and a molecular weight of 469.2 g/mol. IUPAC name: 3,5-dibromo-4-trityl-1,2,4-triazole. InChIKey: IDMQQXDSBDUKBN-UHFFFAOYSA-N.
| Molecular formula | C21H15Br2N3 |
|---|---|
| Molecular weight | 469.2 g/mol |
| IUPAC name | 3,5-dibromo-4-trityl-1,2,4-triazole |
| InChIKey | IDMQQXDSBDUKBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C(=NN=C4Br)Br |
Computed by PubChem (NCBI)