CAS 13987-76-3 appears in our catalog under these names: 3,5,7-Trimethyladamantan-1-ol, 95%, 3,5,7–trimethyladamantan–1–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3,5,7-trimethyladamantan-1-ol (CAS 13987-76-3) is a chemical compound with the molecular formula C13H22O and a molecular weight of 194.31 g/mol. IUPAC name: 3,5,7-trimethyladamantan-1-ol. InChIKey: DVKFVAJDHKVYLK-UHFFFAOYSA-N.
| Molecular formula | C13H22O |
|---|---|
| Molecular weight | 194.31 g/mol |
| IUPAC name | 3,5,7-trimethyladamantan-1-ol |
| InChIKey | DVKFVAJDHKVYLK-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)O)C)C |
Computed by PubChem (NCBI)