CAS 1398771-37-3 is the registry number for (Z)-4,4,5,5-Tetramethyl-2-(1,2,3-triphenylprop-1-en-1-yl)-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
4,4,5,5-tetramethyl-2-[(Z)-1,2,3-triphenylprop-1-enyl]-1,3,2-dioxaborolane (CAS 1398771-37-3) is a chemical compound with the molecular formula C27H29BO2 and a molecular weight of 396.3 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(Z)-1,2,3-triphenylprop-1-enyl]-1,3,2-dioxaborolane. InChIKey: PNIVDUPJQXIVNI-OCOZRVBESA-N.
| Molecular formula | C27H29BO2 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(Z)-1,2,3-triphenylprop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | PNIVDUPJQXIVNI-OCOZRVBESA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C(\CC2=CC=CC=C2)/C3=CC=CC=C3)/C4=CC=CC=C4 |
Computed by PubChem (NCBI)