CAS 1398771-41-9 is the registry number for (E)-2-(2-(Cyclohex-1-en-1-yl)prop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-[(E)-2-(cyclohexen-1-yl)prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1398771-41-9) is a chemical compound with the molecular formula C15H25BO2 and a molecular weight of 248.17 g/mol. IUPAC name: 2-[(E)-2-(cyclohexen-1-yl)prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZCLMLVDAHWTPTJ-VAWYXSNFSA-N.
| Molecular formula | C15H25BO2 |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | 2-[(E)-2-(cyclohexen-1-yl)prop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZCLMLVDAHWTPTJ-VAWYXSNFSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/C2=CCCCC2 |
Computed by PubChem (NCBI)