CAS 256383-45-6 appears in our catalog under these names: 4-N-Nonylphenylboronic acid, 98%, 4-Nonylphenylboronic acid/ 99.13% (existing batch purity), 4–(n–nonyl) Benzeneboronic Acid, 4-n-Nonylbenzeneboronic acid, 98+% , 4-N-Nonylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 10mM (in 1ml dmso), 500mg, 250mg, 100 mg.
(4-nonylphenyl)boronic acid (CAS 256383-45-6) is a chemical compound with the molecular formula C15H25BO2 and a molecular weight of 248.17 g/mol. IUPAC name: (4-nonylphenyl)boronic acid. InChIKey: VONVJOGSLHAKOX-UHFFFAOYSA-N.
| Molecular formula | C15H25BO2 |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | (4-nonylphenyl)boronic acid |
| InChIKey | VONVJOGSLHAKOX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCCCCCCC)(O)O |
Computed by PubChem (NCBI)