CAS 139888-76-9 is the registry number for (1,1-Dimethylethyl)(isocyanatomethoxy)diphenyl-silane. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl-(isocyanatomethoxy)-diphenylsilane (CAS 139888-76-9) is a chemical compound with the molecular formula C18H21NO2Si and a molecular weight of 311.4 g/mol. IUPAC name: tert-butyl-(isocyanatomethoxy)-diphenylsilane. InChIKey: ZLHPOBOWVPKXSG-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2Si |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | tert-butyl-(isocyanatomethoxy)-diphenylsilane |
| InChIKey | ZLHPOBOWVPKXSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCN=C=O |
Computed by PubChem (NCBI)