CAS 139888-80-5 appears in our catalog under these names: 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside, 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 250mg, 1g, 2g, 5g, 1000mg, 2000mg, 5000mg.
[3,4,5-triacetyloxy-6-(2-azidoethoxy)oxan-2-yl]methyl acetate (CAS 139888-80-5) is a chemical compound with the molecular formula C16H23N3O10 and a molecular weight of 417.37 g/mol. IUPAC name: [3,4,5-triacetyloxy-6-(2-azidoethoxy)oxan-2-yl]methyl acetate. InChIKey: DPAXDKFCBLGMIZ-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O10 |
|---|---|
| Molecular weight | 417.37 g/mol |
| IUPAC name | [3,4,5-triacetyloxy-6-(2-azidoethoxy)oxan-2-yl]methyl acetate |
| InChIKey | DPAXDKFCBLGMIZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OCCN=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)